CAS 148942-72-7 appears in our catalog under these names: 5-(Bromomethyl)fluorescein, 5-Bromomethyl-fluorescein. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 2,5mg, 500 μg, 1 mg, 2.5 mg.
6-(bromomethyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 148942-72-7) is a chemical compound with the molecular formula C21H13BrO5 and a molecular weight of 425.2 g/mol. IUPAC name: 6-(bromomethyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: OQHKPJAZGYJYTB-UHFFFAOYSA-N.
| Molecular formula | C21H13BrO5 |
|---|---|
| Molecular weight | 425.2 g/mol |
| IUPAC name | 6-(bromomethyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | OQHKPJAZGYJYTB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CBr)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)