CAS 1489601-73-1 is the registry number for Methyl 4-Fluoro-3-methylbenzo[b]thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate (CAS 1489601-73-1) is a chemical compound with the molecular formula C11H9FO2S and a molecular weight of 224.25 g/mol. IUPAC name: methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate. InChIKey: USSADACTKMEGTI-UHFFFAOYSA-N.
| Molecular formula | C11H9FO2S |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | USSADACTKMEGTI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=CC=CC(=C12)F)C(=O)OC |
Computed by PubChem (NCBI)