CAS 149022-19-5 appears in our catalog under these names: Quin 2 potassium salt xhydrate, 98%, Quin 2 Potassium Salt Hydrate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
CAS 149022-19-5 identifies a chemical compound with the molecular formula C26H29KN3O11 and a molecular weight of 598.6 g/mol. InChIKey: CKEUHPOVDSFCQX-UHFFFAOYSA-N.
| Molecular formula | C26H29KN3O11 |
|---|---|
| Molecular weight | 598.6 g/mol |
| InChIKey | CKEUHPOVDSFCQX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=NC3=C(C=C(C=C3C=C2)OC)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.[K] |
Computed by PubChem (NCBI)