CAS 149045-79-4 appears in our catalog under these names: 5,6-Dichloro-2,2-difluoro-1,3-benzodioxole, 95%, 5,6-Dichloro-2,2-difluorobenzo(d)(1,3)dioxole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
5,6-dichloro-2,2-difluoro-1,3-benzodioxole (CAS 149045-79-4) is a chemical compound with the molecular formula C7H2Cl2F2O2 and a molecular weight of 226.99 g/mol. IUPAC name: 5,6-dichloro-2,2-difluoro-1,3-benzodioxole. InChIKey: VDFORELLOFIVJI-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O2 |
|---|---|
| Molecular weight | 226.99 g/mol |
| IUPAC name | 5,6-dichloro-2,2-difluoro-1,3-benzodioxole |
| InChIKey | VDFORELLOFIVJI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)OC(O2)(F)F |
Computed by PubChem (NCBI)