CAS 14905-30-7 appears in our catalog under these names: Z–Lys(Tfa)–OH, Cbz-Lys(Tfa)-OH 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 10g, 5g, 25g, 100g.
(2S)-2-(phenylmethoxycarbonylamino)-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 14905-30-7) is a chemical compound with the molecular formula C16H19F3N2O5 and a molecular weight of 376.33 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: KJWAGCTWJDRZLH-LBPRGKRZSA-N.
| Molecular formula | C16H19F3N2O5 |
|---|---|
| Molecular weight | 376.33 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| InChIKey | KJWAGCTWJDRZLH-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)