CAS 149068-56-4 appears in our catalog under these names: 4-(Perfluorohexyl) bromobenzene, 95%, 1-Bromo-4-(perfluorohexyl)benzene 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzene (CAS 149068-56-4) is a chemical compound with the molecular formula C12H4BrF13 and a molecular weight of 475.04 g/mol. IUPAC name: 1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzene. InChIKey: GKOWYWPSKDBJAF-UHFFFAOYSA-N.
| Molecular formula | C12H4BrF13 |
|---|---|
| Molecular weight | 475.04 g/mol |
| IUPAC name | 1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzene |
| InChIKey | GKOWYWPSKDBJAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Br |
Computed by PubChem (NCBI)