Products 1490700-62-3

CAS 1490700-62-3 is the registry number for 1-((3-Fluorophenyl)methyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-[(3-fluorophenyl)methyl]cyclohexane-1-carboxylic acid (CAS 1490700-62-3) is a chemical compound with the molecular formula C14H17FO2 and a molecular weight of 236.28 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]cyclohexane-1-carboxylic acid. InChIKey: NZDOIQMRLOIYOY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17FO2
Molecular weight236.28 g/mol
IUPAC name1-[(3-fluorophenyl)methyl]cyclohexane-1-carboxylic acid
InChIKeyNZDOIQMRLOIYOY-UHFFFAOYSA-N
SMILESC1CCC(CC1)(CC2=CC(=CC=C2)F)C(=O)O

Computed by PubChem (NCBI)