CAS 149105-15-7 is the registry number for (4-Bromo-3-methylphenylcarbonyl)pyrrolidine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
(4-bromo-3-methylphenyl)-pyrrolidin-1-ylmethanone (CAS 149105-15-7) is a chemical compound with the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. IUPAC name: (4-bromo-3-methylphenyl)-pyrrolidin-1-ylmethanone. InChIKey: RCAQDBSEMTZVRD-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO |
|---|---|
| Molecular weight | 268.15 g/mol |
| IUPAC name | (4-bromo-3-methylphenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | RCAQDBSEMTZVRD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)N2CCCC2)Br |
Computed by PubChem (NCBI)