CAS 1491150-77-6 appears in our catalog under these names: Syk-IN-1, 98%, Syk–IN–1, SYK-IN-1, Syk-IN-1, 99.18%, 99.18%, Syk-IN-1, 99.18%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 100 mg.
3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-(1H-indol-7-ylamino)-1,2,4-triazine-6-carboxamide (CAS 1491150-77-6) is a chemical compound with the molecular formula C18H22N8O and a molecular weight of 366.4 g/mol. IUPAC name: 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-(1H-indol-7-ylamino)-1,2,4-triazine-6-carboxamide. InChIKey: FPQNRXITKTZFMF-NWDGAFQWSA-N.
| Molecular formula | C18H22N8O |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-(1H-indol-7-ylamino)-1,2,4-triazine-6-carboxamide |
| InChIKey | FPQNRXITKTZFMF-NWDGAFQWSA-N |
| SMILES | C1CC[C@H]([C@H](C1)N)NC2=NC(=C(N=N2)C(=O)N)NC3=CC=CC4=C3NC=C4 |
Computed by PubChem (NCBI)