CAS 149140-54-5 appears in our catalog under these names: Cephalomannine Impurity 7, (3R,4S)-3-((Triethylsilyl)oxy)-4-phenyl-2-azetidinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
(3R,4S)-4-phenyl-3-triethylsilyloxyazetidin-2-one (CAS 149140-54-5) is a chemical compound with the molecular formula C15H23NO2Si and a molecular weight of 277.43 g/mol. IUPAC name: (3R,4S)-4-phenyl-3-triethylsilyloxyazetidin-2-one. InChIKey: FZWHCVWKYWKZHE-UONOGXRCSA-N.
| Molecular formula | C15H23NO2Si |
|---|---|
| Molecular weight | 277.43 g/mol |
| IUPAC name | (3R,4S)-4-phenyl-3-triethylsilyloxyazetidin-2-one |
| InChIKey | FZWHCVWKYWKZHE-UONOGXRCSA-N |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)