CAS 14915-37-8 appears in our catalog under these names: Bis(1-hydroxy-1h-pyridine-2-thionato-o,s)copper, 98%, Bis(1-Hydroxypyridine-2(1H)-thionato-S,O)Copper(II), >95% (HPLC), Copper(II) pyrithione, Bis[1-(hydroxy-κO)-2(1H)-pyridinethionato-κS2]copper, 97%, 97%. Offered by: Combi-blocks, TRC, Thermo Scientific (Acros), Chemat. Available pack sizes: 100g, 25g, 1kg, 500g, 5g, 100mg, 10mg, 50mg.
Copper bis(1-oxidopyridine-2-thione) (CAS 14915-37-8) is a chemical compound with the molecular formula C10H8CuN2O2S2 and a molecular weight of 315.9 g/mol. IUPAC name: copper bis(1-oxidopyridine-2-thione). InChIKey: XDUPUJNNHFTMQS-UHFFFAOYSA-N.
| Molecular formula | C10H8CuN2O2S2 |
|---|---|
| Molecular weight | 315.9 g/mol |
| IUPAC name | copper bis(1-oxidopyridine-2-thione) |
| InChIKey | XDUPUJNNHFTMQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)N(C=C1)[O-].C1=CC(=S)N(C=C1)[O-].[Cu+2] |
Computed by PubChem (NCBI)