Products 1491982-69-4

CAS 1491982-69-4 is the registry number for 5-Cyanospiro(2.3)hexane-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-cyanospiro[2.3]hexane-5-carboxylic acid (CAS 1491982-69-4) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 5-cyanospiro[2.3]hexane-5-carboxylic acid. InChIKey: UZUMMLOFCGBJEE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO2
Molecular weight151.16 g/mol
IUPAC name5-cyanospiro[2.3]hexane-5-carboxylic acid
InChIKeyUZUMMLOFCGBJEE-UHFFFAOYSA-N
SMILESC1CC12CC(C2)(C#N)C(=O)O

Computed by PubChem (NCBI)