CAS 1492-21-3 is the registry number for Phosphoseryl Phosphoserine. Offered by: TRC. Available pack sizes: 500mg.
(2S)-2-[[(2S)-2-amino-3-phosphonooxypropanoyl]amino]-3-phosphonooxypropanoic acid (CAS 1492-21-3) is a chemical compound with the molecular formula C6H14N2O11P2 and a molecular weight of 352.13 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-phosphonooxypropanoyl]amino]-3-phosphonooxypropanoic acid. InChIKey: PNAYBQVLHUSEEO-IMJSIDKUSA-N.
| Molecular formula | C6H14N2O11P2 |
|---|---|
| Molecular weight | 352.13 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phosphonooxypropanoyl]amino]-3-phosphonooxypropanoic acid |
| InChIKey | PNAYBQVLHUSEEO-IMJSIDKUSA-N |
| SMILES | C([C@@H](C(=O)N[C@@H](COP(=O)(O)O)C(=O)O)N)OP(=O)(O)O |
Computed by PubChem (NCBI)