CAS 1492-52-0 appears in our catalog under these names: Z-Ser(Tos)-OMe, 98%, Z–Ser(Tos)–OMe, Z-O-4-Toluenesulfonyl-L-serine methyl ester, Z-Ser(Tos)-OMe 98%, L-Serine, O-[(4-methylphenyl)sulfonyl]-N-[(phenylmethoxy)carbonyl]-, methyl ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 2g, 250mg.
Methyl (2S)-3-(4-methylphenyl)sulfonyloxy-2-(phenylmethoxycarbonylamino)propanoate (CAS 1492-52-0) is a chemical compound with the molecular formula C19H21NO7S and a molecular weight of 407.4 g/mol. IUPAC name: methyl (2S)-3-(4-methylphenyl)sulfonyloxy-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: VHGXRGXCDVQIKS-KRWDZBQOSA-N.
| Molecular formula | C19H21NO7S |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | methyl (2S)-3-(4-methylphenyl)sulfonyloxy-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | VHGXRGXCDVQIKS-KRWDZBQOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](C(=O)OC)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)