CAS 1492029-02-3 is the registry number for Di-tert-butyl (6-bromo-5-chloropyridin-2-yl)iminodicarbonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(6-bromo-5-chloro-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1492029-02-3) is a chemical compound with the molecular formula C15H20BrClN2O4 and a molecular weight of 407.69 g/mol. IUPAC name: tert-butyl N-(6-bromo-5-chloro-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: DWJSWDJUDQYNDJ-UHFFFAOYSA-N.
| Molecular formula | C15H20BrClN2O4 |
|---|---|
| Molecular weight | 407.69 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-5-chloro-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | DWJSWDJUDQYNDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC(=C(C=C1)Cl)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)