CAS 1492054-35-9 appears in our catalog under these names: 5-(BIS(4-CARBOXYBENZYL)AMINO)ISOPHTHALIC ACID, 98%, 98%, 5-(Bis(4-carboxybenzyl)amino)-isophthalic acid, 98%, 5-(Bis(4-carboxybenzyl)amino)isophthalic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-[bis[(4-carboxyphenyl)methyl]amino]benzene-1,3-dicarboxylic acid (CAS 1492054-35-9) is a chemical compound with the molecular formula C24H19NO8 and a molecular weight of 449.4 g/mol. IUPAC name: 5-[bis[(4-carboxyphenyl)methyl]amino]benzene-1,3-dicarboxylic acid. InChIKey: IXSOSENGIKYQKZ-UHFFFAOYSA-N.
| Molecular formula | C24H19NO8 |
|---|---|
| Molecular weight | 449.4 g/mol |
| IUPAC name | 5-[bis[(4-carboxyphenyl)methyl]amino]benzene-1,3-dicarboxylic acid |
| InChIKey | IXSOSENGIKYQKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN(CC2=CC=C(C=C2)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)