CAS 149246-36-6 appears in our catalog under these names: Arbidol Impurity 8, 4-((Dedimethylamino)methyl-2-Bromomethyl-Arbidol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Ethyl 6-bromo-2-(bromomethyl)-5-hydroxy-1-methylindole-3-carboxylate (CAS 149246-36-6) is a chemical compound with the molecular formula C13H13Br2NO3 and a molecular weight of 391.05 g/mol. IUPAC name: ethyl 6-bromo-2-(bromomethyl)-5-hydroxy-1-methylindole-3-carboxylate. InChIKey: CSCYJNGTIGLHLP-UHFFFAOYSA-N.
| Molecular formula | C13H13Br2NO3 |
|---|---|
| Molecular weight | 391.05 g/mol |
| IUPAC name | ethyl 6-bromo-2-(bromomethyl)-5-hydroxy-1-methylindole-3-carboxylate |
| InChIKey | CSCYJNGTIGLHLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=CC(=C(C=C21)O)Br)C)CBr |
Computed by PubChem (NCBI)