CAS 1492513-24-2 appears in our catalog under these names: 5-(Dimethyl-1H-1,2,4-triazol-1-yl)-3-ethyl-1-methyl-1H-pyrazol-4-amine, 95%, 5-(Dimethyl-1H-1,2,4-triazol-1-yl)-3-ethyl-1-methyl-1H-pyrazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-ethyl-1-methylpyrazol-4-amine (CAS 1492513-24-2) is a chemical compound with the molecular formula C10H16N6 and a molecular weight of 220.27 g/mol. IUPAC name: 5-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-ethyl-1-methylpyrazol-4-amine. InChIKey: OVSZTMLSYHJCIK-UHFFFAOYSA-N.
| Molecular formula | C10H16N6 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 5-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-ethyl-1-methylpyrazol-4-amine |
| InChIKey | OVSZTMLSYHJCIK-UHFFFAOYSA-N |
| SMILES | CCC1=NN(C(=C1N)N2C(=NC(=N2)C)C)C |
Computed by PubChem (NCBI)