CAS 149253-41-8 is the registry number for (+)-Nopol. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethanol (CAS 149253-41-8) is a chemical compound with the molecular formula C11H18O and a molecular weight of 166.26 g/mol. IUPAC name: 2-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethanol. InChIKey: ROKSAUSPJGWCSM-NXEZZACHSA-N.
| Molecular formula | C11H18O |
|---|---|
| Molecular weight | 166.26 g/mol |
| IUPAC name | 2-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethanol |
| InChIKey | ROKSAUSPJGWCSM-NXEZZACHSA-N |
| SMILES | CC1([C@@H]2CC=C([C@H]1C2)CCO)C |
Computed by PubChem (NCBI)