CAS 149261-40-5 appears in our catalog under these names: Hexamethylenetetramine tribromide, Hexamethylenetetramine Tribromide, 97%(NMR),RG, 97%(NMR),RG. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Molecular bromine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;hydrobromide (CAS 149261-40-5) is a chemical compound with the molecular formula C6H13Br3N4 and a molecular weight of 380.91 g/mol. IUPAC name: molecular bromine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;hydrobromide. InChIKey: CERSDEAKMGSGGO-UHFFFAOYSA-N.
| Molecular formula | C6H13Br3N4 |
|---|---|
| Molecular weight | 380.91 g/mol |
| IUPAC name | molecular bromine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;hydrobromide |
| InChIKey | CERSDEAKMGSGGO-UHFFFAOYSA-N |
| SMILES | C1N2CN3CN1CN(C2)C3.Br.BrBr |
Computed by PubChem (NCBI)