CAS 1492742-15-0 is the registry number for 4-(Aminomethyl)-N,N-diethylthiophene-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(aminomethyl)-N,N-diethylthiophene-2-sulfonamide (CAS 1492742-15-0) is a chemical compound with the molecular formula C9H16N2O2S2 and a molecular weight of 248.4 g/mol. IUPAC name: 4-(aminomethyl)-N,N-diethylthiophene-2-sulfonamide. InChIKey: UEFYXQXTOCRYSE-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O2S2 |
|---|---|
| Molecular weight | 248.4 g/mol |
| IUPAC name | 4-(aminomethyl)-N,N-diethylthiophene-2-sulfonamide |
| InChIKey | UEFYXQXTOCRYSE-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=CS1)CN |
Computed by PubChem (NCBI)