CAS 149288-34-6 is the registry number for 4-((2,6-Dimethylphenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-[(2,6-dimethylphenoxy)methyl]benzoic acid (CAS 149288-34-6) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 4-[(2,6-dimethylphenoxy)methyl]benzoic acid. InChIKey: BESKEYBHECGTNW-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 4-[(2,6-dimethylphenoxy)methyl]benzoic acid |
| InChIKey | BESKEYBHECGTNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)