Products 1493-25-0

CAS 1493-25-0 is the registry number for Nicotinoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Pyridine-3-carbonyl fluoride (CAS 1493-25-0) is a chemical compound with the molecular formula C6H4FNO and a molecular weight of 125.10 g/mol. IUPAC name: pyridine-3-carbonyl fluoride. InChIKey: GNRFLYPJBUPWPB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4FNO
Molecular weight125.10 g/mol
IUPAC namepyridine-3-carbonyl fluoride
InChIKeyGNRFLYPJBUPWPB-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)C(=O)F

Computed by PubChem (NCBI)