CAS 14931-83-0 is the registry number for Cobalt (ethylenedinitrilo)tetraacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;cobalt(2+) (CAS 14931-83-0) is a chemical compound with the molecular formula C10H12CoN2O8-2 and a molecular weight of 347.14 g/mol. IUPAC name: 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;cobalt(2+). InChIKey: TWJZAIVFYJWAJC-UHFFFAOYSA-J.
| Molecular formula | C10H12CoN2O8-2 |
|---|---|
| Molecular weight | 347.14 g/mol |
| IUPAC name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;cobalt(2+) |
| InChIKey | TWJZAIVFYJWAJC-UHFFFAOYSA-J |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Co+2] |
Computed by PubChem (NCBI)