CAS 149341-33-3 appears in our catalog under these names: (S)-Quinap 98%, (S)-(−)-1-(2-Diphenylphosphino-1-naphthyl)isoquinoline, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 25mg, 50mg, 100mg, 250mg.
(1-isoquinolin-1-ylnaphthalen-2-yl)-diphenylphosphane (CAS 149341-33-3) is a chemical compound with the molecular formula C31H22NP and a molecular weight of 439.5 g/mol. IUPAC name: (1-isoquinolin-1-ylnaphthalen-2-yl)-diphenylphosphane. InChIKey: YMJAIEYASUCCMJ-UHFFFAOYSA-N.
| Molecular formula | C31H22NP |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (1-isoquinolin-1-ylnaphthalen-2-yl)-diphenylphosphane |
| InChIKey | YMJAIEYASUCCMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=NC=CC6=CC=CC=C65 |
Computed by PubChem (NCBI)