Products 149368-06-9
CAS 149368-06-9 appears in our catalog under these names: Hyaluronic acid disaccharide sodium salt, Hyaluronic acid disaccharide sodium salt, ≥95%, ≥95%, Hyaluronic acid disaccharide sodium salt, 1 mg, Hyaluronic acid disaccharide sodium salt, 2 mg, Hyaluronic acid disaccharide sodium salt, 5 mg. Offered by: Biosynth, Chemat, Roth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
Sodium (2R,3R,4S)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate (CAS 149368-06-9) is a chemical compound with the molecular formula C14H20NNaO11 and a molecular weight of 401.30 g/mol. IUPAC name: sodium (2R,3R,4S)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate. InChIKey: RCSGFYXVBIMRPV-WYBHFVFNSA-M.
| Molecular formula | C14H20NNaO11 |
|---|---|
| Molecular weight | 401.30 g/mol |
| IUPAC name | sodium (2R,3R,4S)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylate |
| InChIKey | RCSGFYXVBIMRPV-WYBHFVFNSA-M |
| SMILES | CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O[C@H]1[C@@H]([C@H](C=C(O1)C(=O)[O-])O)O.[Na+] |
Computed by PubChem (NCBI)