CAS 149404-21-7 appears in our catalog under these names: Enalapril sodium, Enalapril (sodium). Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
Sodium (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate (CAS 149404-21-7) is a chemical compound with the molecular formula C20H27N2NaO5 and a molecular weight of 398.4 g/mol. IUPAC name: sodium (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate. InChIKey: FTTHROYWFRGKST-BDURURIASA-M.
| Molecular formula | C20H27N2NaO5 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | sodium (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate |
| InChIKey | FTTHROYWFRGKST-BDURURIASA-M |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)