CAS 149409-57-4 appears in our catalog under these names: NE 100 Hydrochloride, NE-100 hydrochloride/ 98.85% (existing batch purity), NE 100 hydrochloride, NE-100, NE 100, ≥95%, ≥95%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg, 50mg, 100mg, 200mg.
N-[2-[4-methoxy-3-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine;hydrochloride (CAS 149409-57-4) is a chemical compound with the molecular formula C23H34ClNO2 and a molecular weight of 392.0 g/mol. IUPAC name: N-[2-[4-methoxy-3-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine;hydrochloride. InChIKey: ZHGMDXSHODHWHV-UHFFFAOYSA-N.
| Molecular formula | C23H34ClNO2 |
|---|---|
| Molecular weight | 392.0 g/mol |
| IUPAC name | N-[2-[4-methoxy-3-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine;hydrochloride |
| InChIKey | ZHGMDXSHODHWHV-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCC1=CC(=C(C=C1)OC)OCCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)