Products 14943-53-4
CAS 14943-53-4 appears in our catalog under these names: Oxybutynin hydrochloride EP Impurity B, Oxybutynin EP Impurity B, Oxybutynin Impurity 2（Oxybutynin EP Impurity B）, a-Descyclohexyl-a-phenyl Oxybutynin, >95% (HPLC), Alpha-Descyclohexyl-Alpha-phenyl Oxybutynin, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate (CAS 14943-53-4) is a chemical compound with the molecular formula C22H25NO3 and a molecular weight of 351.4 g/mol. IUPAC name: 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate. InChIKey: YGGLNZUXAWIXQH-UHFFFAOYSA-N.
| Molecular formula | C22H25NO3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate |
| InChIKey | YGGLNZUXAWIXQH-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC#CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)
Synonyms:
alpha-Descyclohexyl-alpha-phenyl Oxybutynin, 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate, Oxybutynin hydrochloride impurity B [EP], .ALPHA.-DESCYCLOHEXYL-.ALPHA.-PHENYL OXYBUTYNIN, OXYBUTYNIN HYDROCHLORIDE IMPURITY B [EP IMPURITY], OXYBUTYNIN HYDROCHLORIDE IMPURITY B (EP IMPURITY), Oxybutynin chloride impurity, diphenyl analog of oxybutynin chloride-(USP), Oxybutynin chloride impurity, diphenyl analog of oxybutynin chloride-[USP], Oxybutynin hydrochloride impurity B, Oxybutynin EP Impurity B