CAS 1494603-44-9 is the registry number for 5-(3-Fluoro-4-methoxyphenyl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(3-fluoro-4-methoxyphenyl)imidazolidine-2,4-dione (CAS 1494603-44-9) is a chemical compound with the molecular formula C10H9FN2O3 and a molecular weight of 224.19 g/mol. IUPAC name: 5-(3-fluoro-4-methoxyphenyl)imidazolidine-2,4-dione. InChIKey: QISSMIRHADVASM-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O3 |
|---|---|
| Molecular weight | 224.19 g/mol |
| IUPAC name | 5-(3-fluoro-4-methoxyphenyl)imidazolidine-2,4-dione |
| InChIKey | QISSMIRHADVASM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2C(=O)NC(=O)N2)F |
Computed by PubChem (NCBI)