Products 1495521-73-7
CAS 1495521-73-7 is the registry number for (2-Bromo-5-chlorophenyl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-bromo-5-chlorophenyl)methanesulfonamide (CAS 1495521-73-7) is a chemical compound with the molecular formula C7H7BrClNO2S and a molecular weight of 284.56 g/mol. IUPAC name: (2-bromo-5-chlorophenyl)methanesulfonamide. InChIKey: WBTFVCXSZGNSOH-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClNO2S |
|---|---|
| Molecular weight | 284.56 g/mol |
| IUPAC name | (2-bromo-5-chlorophenyl)methanesulfonamide |
| InChIKey | WBTFVCXSZGNSOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CS(=O)(=O)N)Br |
Computed by PubChem (NCBI)