Products 1495702-23-2
CAS 1495702-23-2 is the registry number for 5-Bromo-1-((3-methyl-1,2,4-oxadiazol-5-yl)methyl)pyridin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one (CAS 1495702-23-2) is a chemical compound with the molecular formula C9H8BrN3O2 and a molecular weight of 270.08 g/mol. IUPAC name: 5-bromo-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one. InChIKey: LDJXKXIMVIBDFC-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O2 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 5-bromo-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one |
| InChIKey | LDJXKXIMVIBDFC-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CN2C=C(C=CC2=O)Br |
Computed by PubChem (NCBI)