CAS 1495923-92-6 appears in our catalog under these names: 2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine, 95%, 2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (CAS 1495923-92-6) is a chemical compound with the molecular formula C13H13FN2S and a molecular weight of 248.32 g/mol. IUPAC name: 2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine. InChIKey: OKGUVMKYAWJIHF-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2S |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| InChIKey | OKGUVMKYAWJIHF-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)SC(=N2)C3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)