Products 1496636-53-3

CAS 1496636-53-3 is the registry number for Di-tert-butyl propane-1,1-diyldicarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (CAS 1496636-53-3) is a chemical compound with the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. IUPAC name: tert-butyl N-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate. InChIKey: COVUALLVCOCXRO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H26N2O4
Molecular weight274.36 g/mol
IUPAC nametert-butyl N-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate
InChIKeyCOVUALLVCOCXRO-UHFFFAOYSA-N
SMILESCCC(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)