CAS 149690-05-1 appears in our catalog under these names: Sacubitril sodium, 98%, Sacubitril Sodium, Sacubitril Sodium Salt, >95% (HPLC), Sacubitril sodium, Sacubitril Sodium Salt, 98%, 98%. Offered by: AmBeed, Mikromol, TRC, TargetMol, GLPBio. Available pack sizes: 10mg, 100mg, 50mg, 5mg, 250mg, 1g, 500mg, 25mg.
Sodium 4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoate (CAS 149690-05-1) is a chemical compound with the molecular formula C24H28NNaO5 and a molecular weight of 433.5 g/mol. IUPAC name: sodium 4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoate. InChIKey: RRTBVEJIZWGATF-JKSHRDEXSA-M.
| Molecular formula | C24H28NNaO5 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | sodium 4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoate |
| InChIKey | RRTBVEJIZWGATF-JKSHRDEXSA-M |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)