CAS 149697-40-5 is the registry number for Bis(4-chlorooctafluorobutyl)ether, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-chloro-4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutoxy)-1,1,2,2,3,3,4,4-octafluorobutane (CAS 149697-40-5) is a chemical compound with the molecular formula C8Cl2F16O and a molecular weight of 486.96 g/mol. IUPAC name: 1-chloro-4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutoxy)-1,1,2,2,3,3,4,4-octafluorobutane. InChIKey: YGAVLUGHTWKNCY-UHFFFAOYSA-N.
| Molecular formula | C8Cl2F16O |
|---|---|
| Molecular weight | 486.96 g/mol |
| IUPAC name | 1-chloro-4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutoxy)-1,1,2,2,3,3,4,4-octafluorobutane |
| InChIKey | YGAVLUGHTWKNCY-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)Cl)(F)F)(C(OC(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)