CAS 1497024-48-2 is the registry number for 6-Bromo-1-(1,1-dioxidotetrahydrothiophen-3-yl)-1,3-dihydro-2H-benzo[d]imidazole-2-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-(1,1-dioxothiolan-3-yl)-1H-benzimidazole-2-thione (CAS 1497024-48-2) is a chemical compound with the molecular formula C11H11BrN2O2S2 and a molecular weight of 347.3 g/mol. IUPAC name: 5-bromo-3-(1,1-dioxothiolan-3-yl)-1H-benzimidazole-2-thione. InChIKey: PRUPHUNBDWTGAV-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2S2 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 5-bromo-3-(1,1-dioxothiolan-3-yl)-1H-benzimidazole-2-thione |
| InChIKey | PRUPHUNBDWTGAV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=CC(=C3)Br)NC2=S |
Computed by PubChem (NCBI)