CAS 1241608-58-1 is the registry number for 3-Bromo-N-((4-methylthiazol-2-yl)methyl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide (CAS 1241608-58-1) is a chemical compound with the molecular formula C11H11BrN2O2S2 and a molecular weight of 347.3 g/mol. IUPAC name: 3-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide. InChIKey: LICFKTVCTLQAJV-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2S2 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 3-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzenesulfonamide |
| InChIKey | LICFKTVCTLQAJV-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)CNS(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)