Products 1497249-95-2
CAS 1497249-95-2 is the registry number for KHG26693. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(1-adamantyl)-4-methyl-1,3-thiazol-2-amine (CAS 1497249-95-2) is a chemical compound with the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. IUPAC name: N-(1-adamantyl)-4-methyl-1,3-thiazol-2-amine. InChIKey: JMRLYCMPIVIOSE-UHFFFAOYSA-N.
| Molecular formula | C14H20N2S |
|---|---|
| Molecular weight | 248.39 g/mol |
| IUPAC name | N-(1-adamantyl)-4-methyl-1,3-thiazol-2-amine |
| InChIKey | JMRLYCMPIVIOSE-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)
Synonyms:
N-adamantyl-4-methylthiazol-2-amine, orb1703277