CAS 14973-52-5 is the registry number for Copper(II) 2-naphthoate trihydrate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(naphthalene-2-carboxylate) (CAS 14973-52-5) is a chemical compound with the molecular formula C22H14CuO4 and a molecular weight of 405.9 g/mol. IUPAC name: copper bis(naphthalene-2-carboxylate). InChIKey: OHGJVAFVIMGJTE-UHFFFAOYSA-L.
| Molecular formula | C22H14CuO4 |
|---|---|
| Molecular weight | 405.9 g/mol |
| IUPAC name | copper bis(naphthalene-2-carboxylate) |
| InChIKey | OHGJVAFVIMGJTE-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)[O-].C1=CC=C2C=C(C=CC2=C1)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)