CAS 1497439-74-3 is the registry number for AD-8007, 99.36%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 50 mg, 5 mg.
(2S)-2-amino-2-cyclopropyl-1-(3,3-diphenylpiperidin-1-yl)ethanone (CAS 1497439-74-3) is a chemical compound with the molecular formula C22H26N2O and a molecular weight of 334.5 g/mol. IUPAC name: (2S)-2-amino-2-cyclopropyl-1-(3,3-diphenylpiperidin-1-yl)ethanone. InChIKey: RVDAHWSYHUHTAL-FQEVSTJZSA-N.
| Molecular formula | C22H26N2O |
|---|---|
| Molecular weight | 334.5 g/mol |
| IUPAC name | (2S)-2-amino-2-cyclopropyl-1-(3,3-diphenylpiperidin-1-yl)ethanone |
| InChIKey | RVDAHWSYHUHTAL-FQEVSTJZSA-N |
| SMILES | C1CC(CN(C1)C(=O)[C@H](C2CC2)N)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)