CAS 14975-30-5 appears in our catalog under these names: H-Arg-NH2 dihydrochloride, 97%, L-Argininamide dihydrochloride/ 100%, H–Arg–NH2·2HCl, L-Argininamide dihydrochloride, L-Argininamide Dihydrochloride [for Protein Research], >95.0%(HPLC). Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 100g, 25g, 1g, 50mg, 100mg, 200mg, 50g.
(2S)-2-amino-5-(diaminomethylideneamino)pentanamide;dihydrochloride (CAS 14975-30-5) is a chemical compound with the molecular formula C6H17Cl2N5O and a molecular weight of 246.14 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)pentanamide;dihydrochloride. InChIKey: LYMQLFYWIDCFLC-FHNDMYTFSA-N.
| Molecular formula | C6H17Cl2N5O |
|---|---|
| Molecular weight | 246.14 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)pentanamide;dihydrochloride |
| InChIKey | LYMQLFYWIDCFLC-FHNDMYTFSA-N |
| SMILES | C(C[C@@H](C(=O)N)N)CN=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)