CAS 1498158-04-5 appears in our catalog under these names: 4–(4–Iodo–1H–pyrazol–1–yl)benzonitrile, 4-(4-iodo-1H-pyrazol-1-yl)benzonitrile, 97%, 97%, 4-(4-Iodo-1H-pyrazol-1-yl)benzonitrile, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(4-iodopyrazol-1-yl)benzonitrile (CAS 1498158-04-5) is a chemical compound with the molecular formula C10H6IN3 and a molecular weight of 295.08 g/mol. IUPAC name: 4-(4-iodopyrazol-1-yl)benzonitrile. InChIKey: WXPRXXLCEZGKON-UHFFFAOYSA-N.
| Molecular formula | C10H6IN3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 4-(4-iodopyrazol-1-yl)benzonitrile |
| InChIKey | WXPRXXLCEZGKON-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)N2C=C(C=N2)I |
Computed by PubChem (NCBI)