CAS 149817-62-9 appears in our catalog under these names: 4'-Bromo-2,2':6',2''-terpyridine, >95% (HPLC), 4'–Bromo–2,2':6',2''–terpyridine, 4'-Bromo-2,2':6',2''-terpyridine, >97.0%(HPLC)(T), 4'-Bromo-2,2':6',2''-terpyridine, 97%, 97%, 4'-Bromo-2,2':6',2''-terpyridine, 97%. Offered by: TRC, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 25mg, 1g, 5g, 250mg, 25g.
4-bromo-2,6-dipyridin-2-ylpyridine (CAS 149817-62-9) is a chemical compound with the molecular formula C15H10BrN3 and a molecular weight of 312.16 g/mol. IUPAC name: 4-bromo-2,6-dipyridin-2-ylpyridine. InChIKey: CJRRILXBSCRHKN-UHFFFAOYSA-N.
| Molecular formula | C15H10BrN3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | 4-bromo-2,6-dipyridin-2-ylpyridine |
| InChIKey | CJRRILXBSCRHKN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)Br |
Computed by PubChem (NCBI)