Products 1498186-01-8
CAS 1498186-01-8 is the registry number for Kv3 modulator 3. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, Get quote.
3-methyl-4-[6-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxy-3-pyridinyl]-1H-1,2,4-triazol-5-one (CAS 1498186-01-8) is a chemical compound with the molecular formula C19H18N4O3 and a molecular weight of 350.4 g/mol. IUPAC name: 3-methyl-4-[6-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxy-3-pyridinyl]-1H-1,2,4-triazol-5-one. InChIKey: SXVVXFKHWPURFB-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 3-methyl-4-[6-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxy-3-pyridinyl]-1H-1,2,4-triazol-5-one |
| InChIKey | SXVVXFKHWPURFB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)OC3=NC=C(C=C3)N4C(=NNC4=O)C)C5(CC5)CO2 |
Computed by PubChem (NCBI)
Synonyms:
Kv3 modulator 3, orb1709307