CAS 149845-07-8 appears in our catalog under these names: Tiludronic acid disodium salt, 95%, Tiludronic Acid Disodium Salt, >95% (HPLC), Tiludronate disodium/ 100%, Tiludronate disodium, Tiludronic acid disodium salt. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 25mg, 100mg, 250mg, 50mg, 5mg, 10mg, 500mg, 1mg.
Disodium;[(4-chlorophenyl)sulfanyl-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate (CAS 149845-07-8) is a chemical compound with the molecular formula C7H7ClNa2O6P2S and a molecular weight of 362.57 g/mol. IUPAC name: disodium;[(4-chlorophenyl)sulfanyl-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate. InChIKey: SKUHWSDHMJMHIW-UHFFFAOYSA-L.
| Molecular formula | C7H7ClNa2O6P2S |
|---|---|
| Molecular weight | 362.57 g/mol |
| IUPAC name | disodium;[(4-chlorophenyl)sulfanyl-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate |
| InChIKey | SKUHWSDHMJMHIW-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1SC(P(=O)(O)[O-])P(=O)(O)[O-])Cl.[Na+].[Na+] |
Computed by PubChem (NCBI)