CAS 14985-44-5 appears in our catalog under these names: 8-Bromo-2'-deoxyadenosine, 5 g, 8-Bromo-2'-deoxyadenosine, 95%, (2R,3S,5R)–5–(6–Amino–8–bromo–9H–purin–9–yl)–2–(hydroxymethyl)tetrahydrofuran–3–ol, 8-Bromo-2'-deoxyadenosine, 99% , 8-Bromo-2'-deoxyadenosine. Offered by: Roth, Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg, 1000mg, 500mg.
(2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 14985-44-5) is a chemical compound with the molecular formula C10H12BrN5O3 and a molecular weight of 330.14 g/mol. IUPAC name: (2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: NJBIVXMQFIQOGE-KVQBGUIXSA-N.
| Molecular formula | C10H12BrN5O3 |
|---|---|
| Molecular weight | 330.14 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | NJBIVXMQFIQOGE-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C3=NC=NC(=C3N=C2Br)N)CO)O |
Computed by PubChem (NCBI)