CAS 1499162-60-5 is the registry number for MAP4K4-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2-fluoro-4-pyridinyl)pyrido[3,2-d]pyrimidin-4-amine (CAS 1499162-60-5) is a chemical compound with the molecular formula C12H8FN5 and a molecular weight of 241.22 g/mol. IUPAC name: 6-(2-fluoro-4-pyridinyl)pyrido[3,2-d]pyrimidin-4-amine. InChIKey: CLODUYRNZMIONW-UHFFFAOYSA-N.
| Molecular formula | C12H8FN5 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 6-(2-fluoro-4-pyridinyl)pyrido[3,2-d]pyrimidin-4-amine |
| InChIKey | CLODUYRNZMIONW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=CN=C2N)C3=CC(=NC=C3)F |
Computed by PubChem (NCBI)