CAS 14994-00-4 is the registry number for 2,2,2-Trichloroethane-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2,2-trichloroethanesulfonyl chloride (CAS 14994-00-4) is a chemical compound with the molecular formula C2H2Cl4O2S and a molecular weight of 231.9 g/mol. IUPAC name: 2,2,2-trichloroethanesulfonyl chloride. InChIKey: CNWRAKGWZMUEAT-UHFFFAOYSA-N.
| Molecular formula | C2H2Cl4O2S |
|---|---|
| Molecular weight | 231.9 g/mol |
| IUPAC name | 2,2,2-trichloroethanesulfonyl chloride |
| InChIKey | CNWRAKGWZMUEAT-UHFFFAOYSA-N |
| SMILES | C(C(Cl)(Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)