CAS 1499430-03-3 is the registry number for 2-(6-Bromo-3-chloro-2-fluorophenyl)acetonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(6-bromo-3-chloro-2-fluorophenyl)acetonitrile (CAS 1499430-03-3) is a chemical compound with the molecular formula C8H4BrClFN and a molecular weight of 248.48 g/mol. IUPAC name: 2-(6-bromo-3-chloro-2-fluorophenyl)acetonitrile. InChIKey: JGBPXRYQMCEJDP-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClFN |
|---|---|
| Molecular weight | 248.48 g/mol |
| IUPAC name | 2-(6-bromo-3-chloro-2-fluorophenyl)acetonitrile |
| InChIKey | JGBPXRYQMCEJDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)F)CC#N)Br |
Computed by PubChem (NCBI)